C26H23N3O5S — CID 25116790
N-hydroxy-2-[(3S)-2-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetamide (PubChem CID 25116790) has the molecular formula C26H23N3O5S and a molecular weight of 489.55 g/mol. Its IUPAC name is N-hydroxy-2-[(3S)-2-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetamide.
| Compound Name | N-hydroxy-2-[(3S)-2-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetamide |
|---|---|
| PubChem CID | 25116790 |
| Molecular Formula | C26H23N3O5S |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | N-hydroxy-2-[(3S)-2-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetamide |
| SMILES | Cc1cc(COc2ccc(N3[C@@H](CC(=O)NO)c4ccccc4S3(=O)=O)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C26H23N3O5S/c1-17-14-18(21-6-2-4-8-23(21)27-17)16-34-20-12-10-19(11-13-20)29-24(15-26(30)28-31)22-7-3-5-9-25(22)35(29,32)33/h2-14,24,31H,15-16H2,1H3,(H,28,30)/t24-/m0/s1 |
| InChIKey | IDSMTHISFQDTOW-DEOSSOPVSA-N |
| XLogP | 4.27 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|