C27H25N3O5S — CID 25117240
N-hydroxy-2-[2-[4-[1-(2-methylquinolin-4-yl)ethoxy]phenyl]-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetamide (PubChem CID 25117240) has the molecular formula C27H25N3O5S and a molecular weight of 503.58 g/mol. Its IUPAC name is N-hydroxy-2-[2-[4-[1-(2-methylquinolin-4-yl)ethoxy]phenyl]-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetamide.
| Compound Name | N-hydroxy-2-[2-[4-[1-(2-methylquinolin-4-yl)ethoxy]phenyl]-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetamide |
|---|---|
| PubChem CID | 25117240 |
| Molecular Formula | C27H25N3O5S |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | N-hydroxy-2-[2-[4-[1-(2-methylquinolin-4-yl)ethoxy]phenyl]-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetamide |
| SMILES | Cc1cc(C(C)Oc2ccc(N3C(CC(=O)NO)c4ccccc4S3(=O)=O)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C27H25N3O5S/c1-17-15-23(21-7-3-5-9-24(21)28-17)18(2)35-20-13-11-19(12-14-20)30-25(16-27(31)29-32)22-8-4-6-10-26(22)36(30,33)34/h3-15,18,25,32H,16H2,1-2H3,(H,29,31) |
| InChIKey | VVWJNGGRSBGDSF-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|