C16H13F3N2O5S — CID 140557854
2-[1,1-dioxo-2-phenyl-5-(trifluoromethoxy)-3H-1,2-benzothiazol-3-yl]-N-hydroxyacetamide (PubChem CID 140557854) has the molecular formula C16H13F3N2O5S and a molecular weight of 402.35 g/mol. Its IUPAC name is 2-[1,1-dioxo-2-phenyl-5-(trifluoromethoxy)-3H-1,2-benzothiazol-3-yl]-N-hydroxyacetamide.
| Compound Name | 2-[1,1-dioxo-2-phenyl-5-(trifluoromethoxy)-3H-1,2-benzothiazol-3-yl]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 140557854 |
| Molecular Formula | C16H13F3N2O5S |
| Molecular Weight | 402.35 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | 2-[1,1-dioxo-2-phenyl-5-(trifluoromethoxy)-3H-1,2-benzothiazol-3-yl]-N-hydroxyacetamide |
| SMILES | O=C(CC1c2cc(OC(F)(F)F)ccc2S(=O)(=O)N1c1ccccc1)NO |
| InChI | InChI=1S/C16H13F3N2O5S/c17-16(18,19)26-11-6-7-14-12(8-11)13(9-15(22)20-23)21(27(14,24)25)10-4-2-1-3-5-10/h1-8,13,23H,9H2,(H,20,22) |
| InChIKey | CELHHPILJNPMNE-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.35 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|