C21H25N3O4S — CID 25116567
2-[2-(1-benzylpiperidin-4-yl)-1,1-dioxo-3H-1,2-benzothiazol-3-yl]-N-hydroxyacetamide (PubChem CID 25116567) has the molecular formula C21H25N3O4S and a molecular weight of 415.52 g/mol. Its IUPAC name is 2-[2-(1-benzylpiperidin-4-yl)-1,1-dioxo-3H-1,2-benzothiazol-3-yl]-N-hydroxyacetamide.
| Compound Name | 2-[2-(1-benzylpiperidin-4-yl)-1,1-dioxo-3H-1,2-benzothiazol-3-yl]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 25116567 |
| Molecular Formula | C21H25N3O4S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 2-[2-(1-benzylpiperidin-4-yl)-1,1-dioxo-3H-1,2-benzothiazol-3-yl]-N-hydroxyacetamide |
| SMILES | O=C(CC1c2ccccc2S(=O)(=O)N1C1CCN(Cc2ccccc2)CC1)NO |
| InChI | InChI=1S/C21H25N3O4S/c25-21(22-26)14-19-18-8-4-5-9-20(18)29(27,28)24(19)17-10-12-23(13-11-17)15-16-6-2-1-3-7-16/h1-9,17,19,26H,10-15H2,(H,22,25) |
| InChIKey | HGTSFZOBRLZPOR-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|