C24H24N2O3 — CID 163774291
(1R,5R)-N-hydroxy-5-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]cyclohex-2-ene-1-carboxamide (PubChem CID 163774291) has the molecular formula C24H24N2O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is (1R,5R)-N-hydroxy-5-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]cyclohex-2-ene-1-carboxamide.
| Compound Name | (1R,5R)-N-hydroxy-5-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]cyclohex-2-ene-1-carboxamide |
|---|---|
| PubChem CID | 163774291 |
| Molecular Formula | C24H24N2O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | (1R,5R)-N-hydroxy-5-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]cyclohex-2-ene-1-carboxamide |
| SMILES | Cc1cc(COc2ccc([C@@H]3CC=C[C@H](C(=O)NO)C3)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C24H24N2O3/c1-16-13-20(22-7-2-3-8-23(22)25-16)15-29-21-11-9-17(10-12-21)18-5-4-6-19(14-18)24(27)26-28/h2-4,6-13,18-19,28H,5,14-15H2,1H3,(H,26,27)/t18-,19+/m1/s1 |
| InChIKey | MJBUAHVGGRWQPG-MOPGFXCFSA-N |
| XLogP | 4.68 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|