C32H29N5O5 — CID 87976925
(3R,4S)-1-(4-cyanobenzoyl)-3-N-hydroxy-4-N-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]piperidine-3,4-dicarboxamide (PubChem CID 87976925) has the molecular formula C32H29N5O5 and a molecular weight of 563.61 g/mol. Its IUPAC name is (3R,4S)-1-(4-cyanobenzoyl)-3-N-hydroxy-4-N-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]piperidine-3,4-dicarboxamide.
| Compound Name | (3R,4S)-1-(4-cyanobenzoyl)-3-N-hydroxy-4-N-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]piperidine-3,4-dicarboxamide |
|---|---|
| PubChem CID | 87976925 |
| Molecular Formula | C32H29N5O5 |
| Molecular Weight | 563.61 g/mol |
| Exact Mass | 563.22 |
| IUPAC Name | (3R,4S)-1-(4-cyanobenzoyl)-3-N-hydroxy-4-N-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]piperidine-3,4-dicarboxamide |
| SMILES | Cc1cc(COc2ccc(NC(=O)[C@H]3CCN(C(=O)c4ccc(C#N)cc4)C[C@@H]3C(=O)NO)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C32H29N5O5/c1-20-16-23(26-4-2-3-5-29(26)34-20)19-42-25-12-10-24(11-13-25)35-30(38)27-14-15-37(18-28(27)31(39)36-41)32(40)22-8-6-21(17-33)7-9-22/h2-13,16,27-28,41H,14-15,18-19H2,1H3,(H,35,38)(H,36,39)/t27-,28-/m0/s1 |
| InChIKey | RVYAEMLWCZKBMK-NSOVKSMOSA-N |
| XLogP | 4.22 |
| TPSA | 144.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.61 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|