C27H31N5O4 — CID 91465181
(3R,4R)-N-hydroxy-4-[[4-[(2-methylquinolin-4-yl)methoxy]benzoyl]amino]-1-pyrrolidin-3-ylpyrrolidine-3-carboxamide (PubChem CID 91465181) has the molecular formula C27H31N5O4 and a molecular weight of 489.58 g/mol. Its IUPAC name is (3R,4R)-N-hydroxy-4-[[4-[(2-methylquinolin-4-yl)methoxy]benzoyl]amino]-1-pyrrolidin-3-ylpyrrolidine-3-carboxamide.
| Compound Name | (3R,4R)-N-hydroxy-4-[[4-[(2-methylquinolin-4-yl)methoxy]benzoyl]amino]-1-pyrrolidin-3-ylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 91465181 |
| Molecular Formula | C27H31N5O4 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | (3R,4R)-N-hydroxy-4-[[4-[(2-methylquinolin-4-yl)methoxy]benzoyl]amino]-1-pyrrolidin-3-ylpyrrolidine-3-carboxamide |
| SMILES | Cc1cc(COc2ccc(C(=O)N[C@H]3CN(C4CCNC4)C[C@H]3C(=O)NO)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C27H31N5O4/c1-17-12-19(22-4-2-3-5-24(22)29-17)16-36-21-8-6-18(7-9-21)26(33)30-25-15-32(20-10-11-28-13-20)14-23(25)27(34)31-35/h2-9,12,20,23,25,28,35H,10-11,13-16H2,1H3,(H,30,33)(H,31,34)/t20?,23-,25+/m1/s1 |
| InChIKey | OFJXVJFSDXOZNP-CSGRTZOKSA-N |
| XLogP | 2.02 |
| TPSA | 115.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|