C30H29F3N4O8S2 — CID 87977080
(3R,4S)-3-N-hydroxy-4-N-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]-1-thiophen-2-ylsulfonylpiperidine-3,4-dicarboxamide;2,2,2-trifluoroacetic acid (PubChem CID 87977080) has the molecular formula C30H29F3N4O8S2 and a molecular weight of 694.71 g/mol. Its IUPAC name is (3R,4S)-3-N-hydroxy-4-N-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]-1-thiophen-2-ylsulfonylpiperidine-3,4-dicarboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (3R,4S)-3-N-hydroxy-4-N-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]-1-thiophen-2-ylsulfonylpiperidine-3,4-dicarboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 87977080 |
| Molecular Formula | C30H29F3N4O8S2 |
| Molecular Weight | 694.71 g/mol |
| Exact Mass | 694.14 |
| IUPAC Name | (3R,4S)-3-N-hydroxy-4-N-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]-1-thiophen-2-ylsulfonylpiperidine-3,4-dicarboxamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cc(COc2ccc(NC(=O)[C@H]3CCN(S(=O)(=O)c4cccs4)C[C@@H]3C(=O)NO)cc2)c2ccccc2n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C28H28N4O6S2.C2HF3O2/c1-18-15-19(22-5-2-3-6-25(22)29-18)17-38-21-10-8-20(9-11-21)30-27(33)23-12-13-32(16-24(23)28(34)31-35)40(36,37)26-7-4-14-39-26;3-2(4,5)1(6)7/h2-11,14-15,23-24,35H,12-13,16-17H2,1H3,(H,30,33)(H,31,34);(H,6,7)/t23-,24-;/m0./s1 |
| InChIKey | PEKGZRVRSBYSRQ-UKOKCHKQSA-N |
| XLogP | 4.59 |
| TPSA | 175.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.71 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|