C29H32N4O7 — CID 22956920
[(3S)-oxolan-3-yl] (3R,4S)-3-(hydroxycarbamoyl)-4-[[4-[(2-methylquinolin-4-yl)methoxy]phenyl]carbamoyl]piperidine-1-carboxylate (PubChem CID 22956920) has the molecular formula C29H32N4O7 and a molecular weight of 548.60 g/mol. Its IUPAC name is [(3S)-oxolan-3-yl] (3R,4S)-3-(hydroxycarbamoyl)-4-[[4-[(2-methylquinolin-4-yl)methoxy]phenyl]carbamoyl]piperidine-1-carboxylate.
| Compound Name | [(3S)-oxolan-3-yl] (3R,4S)-3-(hydroxycarbamoyl)-4-[[4-[(2-methylquinolin-4-yl)methoxy]phenyl]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 22956920 |
| Molecular Formula | C29H32N4O7 |
| Molecular Weight | 548.60 g/mol |
| Exact Mass | 548.23 |
| IUPAC Name | [(3S)-oxolan-3-yl] (3R,4S)-3-(hydroxycarbamoyl)-4-[[4-[(2-methylquinolin-4-yl)methoxy]phenyl]carbamoyl]piperidine-1-carboxylate |
| SMILES | Cc1cc(COc2ccc(NC(=O)[C@H]3CCN(C(=O)O[C@H]4CCOC4)C[C@@H]3C(=O)NO)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C29H32N4O7/c1-18-14-19(23-4-2-3-5-26(23)30-18)16-39-21-8-6-20(7-9-21)31-27(34)24-10-12-33(15-25(24)28(35)32-37)29(36)40-22-11-13-38-17-22/h2-9,14,22,24-25,37H,10-13,15-17H2,1H3,(H,31,34)(H,32,35)/t22-,24-,25-/m0/s1 |
| InChIKey | NZBBVQQMKMZNQA-HVCNVCAESA-N |
| XLogP | 3.43 |
| TPSA | 139.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.60 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|