C26H34N4O4 — CID 23001669
2-[3-amino-3-[4-[(2,6-dimethyl-4-pyridinyl)methoxy]phenyl]-2-oxopyrrolidin-1-yl]-2-cyclohexyl-N-hydroxyacetamide (PubChem CID 23001669) has the molecular formula C26H34N4O4 and a molecular weight of 466.58 g/mol. Its IUPAC name is 2-[3-amino-3-[4-[(2,6-dimethyl-4-pyridinyl)methoxy]phenyl]-2-oxopyrrolidin-1-yl]-2-cyclohexyl-N-hydroxyacetamide.
| Compound Name | 2-[3-amino-3-[4-[(2,6-dimethyl-4-pyridinyl)methoxy]phenyl]-2-oxopyrrolidin-1-yl]-2-cyclohexyl-N-hydroxyacetamide |
|---|---|
| PubChem CID | 23001669 |
| Molecular Formula | C26H34N4O4 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | 2-[3-amino-3-[4-[(2,6-dimethyl-4-pyridinyl)methoxy]phenyl]-2-oxopyrrolidin-1-yl]-2-cyclohexyl-N-hydroxyacetamide |
| SMILES | Cc1cc(COc2ccc(C3(N)CCN(C(C(=O)NO)C4CCCCC4)C3=O)cc2)cc(C)n1 |
| InChI | InChI=1S/C26H34N4O4/c1-17-14-19(15-18(2)28-17)16-34-22-10-8-21(9-11-22)26(27)12-13-30(25(26)32)23(24(31)29-33)20-6-4-3-5-7-20/h8-11,14-15,20,23,33H,3-7,12-13,16,27H2,1-2H3,(H,29,31) |
| InChIKey | ASZWCRQMJAFOIG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 117.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|