C20H21Cl2N3O4 — CID 10160295
2-[3-[4-[(2,6-dichloro-4-pyridinyl)methoxy]phenyl]-3-methyl-2-oxopyrrolidin-1-yl]-N-hydroxypropanamide (PubChem CID 10160295) has the molecular formula C20H21Cl2N3O4 and a molecular weight of 438.31 g/mol. Its IUPAC name is 2-[3-[4-[(2,6-dichloro-4-pyridinyl)methoxy]phenyl]-3-methyl-2-oxopyrrolidin-1-yl]-N-hydroxypropanamide.
| Compound Name | 2-[3-[4-[(2,6-dichloro-4-pyridinyl)methoxy]phenyl]-3-methyl-2-oxopyrrolidin-1-yl]-N-hydroxypropanamide |
|---|---|
| PubChem CID | 10160295 |
| Molecular Formula | C20H21Cl2N3O4 |
| Molecular Weight | 438.31 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | 2-[3-[4-[(2,6-dichloro-4-pyridinyl)methoxy]phenyl]-3-methyl-2-oxopyrrolidin-1-yl]-N-hydroxypropanamide |
| SMILES | CC(C(=O)NO)N1CCC(C)(c2ccc(OCc3cc(Cl)nc(Cl)c3)cc2)C1=O |
| InChI | InChI=1S/C20H21Cl2N3O4/c1-12(18(26)24-28)25-8-7-20(2,19(25)27)14-3-5-15(6-4-14)29-11-13-9-16(21)23-17(22)10-13/h3-6,9-10,12,28H,7-8,11H2,1-2H3,(H,24,26) |
| InChIKey | JFJNJERTEPWCHQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.31 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|