C24H24N2O4 — CID 10179360
N-hydroxy-2-[3-methyl-3-(4-naphthalen-1-yloxyphenyl)-2-oxopyrrolidin-1-yl]propanamide (PubChem CID 10179360) has the molecular formula C24H24N2O4 and a molecular weight of 404.47 g/mol. Its IUPAC name is N-hydroxy-2-[3-methyl-3-(4-naphthalen-1-yloxyphenyl)-2-oxopyrrolidin-1-yl]propanamide.
| Compound Name | N-hydroxy-2-[3-methyl-3-(4-naphthalen-1-yloxyphenyl)-2-oxopyrrolidin-1-yl]propanamide |
|---|---|
| PubChem CID | 10179360 |
| Molecular Formula | C24H24N2O4 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | N-hydroxy-2-[3-methyl-3-(4-naphthalen-1-yloxyphenyl)-2-oxopyrrolidin-1-yl]propanamide |
| SMILES | CC(C(=O)NO)N1CCC(C)(c2ccc(Oc3cccc4ccccc34)cc2)C1=O |
| InChI | InChI=1S/C24H24N2O4/c1-16(22(27)25-29)26-15-14-24(2,23(26)28)18-10-12-19(13-11-18)30-21-9-5-7-17-6-3-4-8-20(17)21/h3-13,16,29H,14-15H2,1-2H3,(H,25,27) |
| InChIKey | AJPMUAXFPCXAPI-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|