C24H25N3O4 — CID 44574495
N-hydroxy-2-[3-[4-(naphthalen-1-ylmethoxy)phenyl]-2-oxo-1,3-diazinan-1-yl]propanamide (PubChem CID 44574495) has the molecular formula C24H25N3O4 and a molecular weight of 419.48 g/mol. Its IUPAC name is N-hydroxy-2-[3-[4-(naphthalen-1-ylmethoxy)phenyl]-2-oxo-1,3-diazinan-1-yl]propanamide.
| Compound Name | N-hydroxy-2-[3-[4-(naphthalen-1-ylmethoxy)phenyl]-2-oxo-1,3-diazinan-1-yl]propanamide |
|---|---|
| PubChem CID | 44574495 |
| Molecular Formula | C24H25N3O4 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | N-hydroxy-2-[3-[4-(naphthalen-1-ylmethoxy)phenyl]-2-oxo-1,3-diazinan-1-yl]propanamide |
| SMILES | CC(C(=O)NO)N1CCCN(c2ccc(OCc3cccc4ccccc34)cc2)C1=O |
| InChI | InChI=1S/C24H25N3O4/c1-17(23(28)25-30)26-14-5-15-27(24(26)29)20-10-12-21(13-11-20)31-16-19-8-4-7-18-6-2-3-9-22(18)19/h2-4,6-13,17,30H,5,14-16H2,1H3,(H,25,28) |
| InChIKey | IIJNANCNNFGIQT-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|