C26H30N4O4 — CID 10389612
2-[3-amino-2-oxo-3-[4-(quinolin-4-ylmethoxy)phenyl]pyrrolidin-1-yl]-N-hydroxy-4-methylpentanamide (PubChem CID 10389612) has the molecular formula C26H30N4O4 and a molecular weight of 462.55 g/mol. Its IUPAC name is 2-[3-amino-2-oxo-3-[4-(quinolin-4-ylmethoxy)phenyl]pyrrolidin-1-yl]-N-hydroxy-4-methylpentanamide.
| Compound Name | 2-[3-amino-2-oxo-3-[4-(quinolin-4-ylmethoxy)phenyl]pyrrolidin-1-yl]-N-hydroxy-4-methylpentanamide |
|---|---|
| PubChem CID | 10389612 |
| Molecular Formula | C26H30N4O4 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | 2-[3-amino-2-oxo-3-[4-(quinolin-4-ylmethoxy)phenyl]pyrrolidin-1-yl]-N-hydroxy-4-methylpentanamide |
| SMILES | CC(C)CC(C(=O)NO)N1CCC(N)(c2ccc(OCc3ccnc4ccccc34)cc2)C1=O |
| InChI | InChI=1S/C26H30N4O4/c1-17(2)15-23(24(31)29-33)30-14-12-26(27,25(30)32)19-7-9-20(10-8-19)34-16-18-11-13-28-22-6-4-3-5-21(18)22/h3-11,13,17,23,33H,12,14-16,27H2,1-2H3,(H,29,31) |
| InChIKey | LCTKWVTVYZFBSB-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 117.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|