C22H23Cl2N4O6- — CID 22456100
N-[3-[3-[4-[(2,6-dichloro-4-pyridinyl)methoxy]phenyl]-3-methyl-2-oxopyrrolidin-1-yl]-4-(hydroxyamino)-4-oxobutyl]carbamate (PubChem CID 22456100) has the molecular formula C22H23Cl2N4O6- and a molecular weight of 510.35 g/mol. Its IUPAC name is N-[3-[3-[4-[(2,6-dichloro-4-pyridinyl)methoxy]phenyl]-3-methyl-2-oxopyrrolidin-1-yl]-4-(hydroxyamino)-4-oxobutyl]carbamate.
| Compound Name | N-[3-[3-[4-[(2,6-dichloro-4-pyridinyl)methoxy]phenyl]-3-methyl-2-oxopyrrolidin-1-yl]-4-(hydroxyamino)-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 22456100 |
| Molecular Formula | C22H23Cl2N4O6- |
| Molecular Weight | 510.35 g/mol |
| Exact Mass | 509.10 |
| IUPAC Name | N-[3-[3-[4-[(2,6-dichloro-4-pyridinyl)methoxy]phenyl]-3-methyl-2-oxopyrrolidin-1-yl]-4-(hydroxyamino)-4-oxobutyl]carbamate |
| SMILES | CC1(c2ccc(OCc3cc(Cl)nc(Cl)c3)cc2)CCN(C(CCNC(=O)[O-])C(=O)NO)C1=O |
| InChI | InChI=1S/C22H24Cl2N4O6/c1-22(7-9-28(20(22)30)16(19(29)27-33)6-8-25-21(31)32)14-2-4-15(5-3-14)34-12-13-10-17(23)26-18(24)11-13/h2-5,10-11,16,25,33H,6-9,12H2,1H3,(H,27,29)(H,31,32)/p-1 |
| InChIKey | VDDBRXMSTWGOJU-UHFFFAOYSA-M |
| XLogP | 1.65 |
| TPSA | 143.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.35 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|