C28H30N2O5 — CID 23001577
N-hydroxy-2-[3-methyl-2-oxo-3-(4-phenylmethoxyphenyl)pyrrolidin-1-yl]-3-phenylmethoxypropanamide (PubChem CID 23001577) has the molecular formula C28H30N2O5 and a molecular weight of 474.56 g/mol. Its IUPAC name is N-hydroxy-2-[3-methyl-2-oxo-3-(4-phenylmethoxyphenyl)pyrrolidin-1-yl]-3-phenylmethoxypropanamide.
| Compound Name | N-hydroxy-2-[3-methyl-2-oxo-3-(4-phenylmethoxyphenyl)pyrrolidin-1-yl]-3-phenylmethoxypropanamide |
|---|---|
| PubChem CID | 23001577 |
| Molecular Formula | C28H30N2O5 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | N-hydroxy-2-[3-methyl-2-oxo-3-(4-phenylmethoxyphenyl)pyrrolidin-1-yl]-3-phenylmethoxypropanamide |
| SMILES | CC1(c2ccc(OCc3ccccc3)cc2)CCN(C(COCc2ccccc2)C(=O)NO)C1=O |
| InChI | InChI=1S/C28H30N2O5/c1-28(23-12-14-24(15-13-23)35-19-22-10-6-3-7-11-22)16-17-30(27(28)32)25(26(31)29-33)20-34-18-21-8-4-2-5-9-21/h2-15,25,33H,16-20H2,1H3,(H,29,31) |
| InChIKey | KVFFMCHAVLDTET-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|