C24H39N5O6S — CID 75600338
N-[3-(hydroxyamino)-3-oxo-2-(4-propan-2-ylsulfonylpiperazin-1-yl)propyl]-4-[(1-methylpiperidin-4-yl)methoxy]benzamide (PubChem CID 75600338) has the molecular formula C24H39N5O6S and a molecular weight of 525.67 g/mol. Its IUPAC name is N-[3-(hydroxyamino)-3-oxo-2-(4-propan-2-ylsulfonylpiperazin-1-yl)propyl]-4-[(1-methylpiperidin-4-yl)methoxy]benzamide.
| Compound Name | N-[3-(hydroxyamino)-3-oxo-2-(4-propan-2-ylsulfonylpiperazin-1-yl)propyl]-4-[(1-methylpiperidin-4-yl)methoxy]benzamide |
|---|---|
| PubChem CID | 75600338 |
| Molecular Formula | C24H39N5O6S |
| Molecular Weight | 525.67 g/mol |
| Exact Mass | 525.26 |
| IUPAC Name | N-[3-(hydroxyamino)-3-oxo-2-(4-propan-2-ylsulfonylpiperazin-1-yl)propyl]-4-[(1-methylpiperidin-4-yl)methoxy]benzamide |
| SMILES | CC(C)S(=O)(=O)N1CCN(C(CNC(=O)c2ccc(OCC3CCN(C)CC3)cc2)C(=O)NO)CC1 |
| InChI | InChI=1S/C24H39N5O6S/c1-18(2)36(33,34)29-14-12-28(13-15-29)22(24(31)26-32)16-25-23(30)20-4-6-21(7-5-20)35-17-19-8-10-27(3)11-9-19/h4-7,18-19,22,32H,8-17H2,1-3H3,(H,25,30)(H,26,31) |
| InChIKey | XUZRFPLJFWSQHS-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 131.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.67 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|