C24H26F3N5O4 — CID 51034645
N-[(2S)-3-(hydroxyamino)-3-oxo-2-piperidin-1-ylpropyl]-4-[[2-(trifluoromethyl)pyrazolo[1,5-a]pyridin-3-yl]methoxy]benzamide (PubChem CID 51034645) has the molecular formula C24H26F3N5O4 and a molecular weight of 505.50 g/mol. Its IUPAC name is N-[(2S)-3-(hydroxyamino)-3-oxo-2-piperidin-1-ylpropyl]-4-[[2-(trifluoromethyl)pyrazolo[1,5-a]pyridin-3-yl]methoxy]benzamide.
| Compound Name | N-[(2S)-3-(hydroxyamino)-3-oxo-2-piperidin-1-ylpropyl]-4-[[2-(trifluoromethyl)pyrazolo[1,5-a]pyridin-3-yl]methoxy]benzamide |
|---|---|
| PubChem CID | 51034645 |
| Molecular Formula | C24H26F3N5O4 |
| Molecular Weight | 505.50 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | N-[(2S)-3-(hydroxyamino)-3-oxo-2-piperidin-1-ylpropyl]-4-[[2-(trifluoromethyl)pyrazolo[1,5-a]pyridin-3-yl]methoxy]benzamide |
| SMILES | O=C(NC[C@@H](C(=O)NO)N1CCCCC1)c1ccc(OCc2c(C(F)(F)F)nn3ccccc23)cc1 |
| InChI | InChI=1S/C24H26F3N5O4/c25-24(26,27)21-18(19-6-2-5-13-32(19)29-21)15-36-17-9-7-16(8-10-17)22(33)28-14-20(23(34)30-35)31-11-3-1-4-12-31/h2,5-10,13,20,35H,1,3-4,11-12,14-15H2,(H,28,33)(H,30,34)/t20-/m0/s1 |
| InChIKey | MBZHGJPHJCQQMB-FQEVSTJZSA-N |
| XLogP | 3.02 |
| TPSA | 108.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.50 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|