C33H38N4O5 — CID 75600398
N-[2-(4-benzylpiperazin-1-yl)-3-(hydroxyamino)-3-oxopropyl]-4-[(2-propan-2-yl-1-benzofuran-3-yl)methoxy]benzamide (PubChem CID 75600398) has the molecular formula C33H38N4O5 and a molecular weight of 570.69 g/mol. Its IUPAC name is N-[2-(4-benzylpiperazin-1-yl)-3-(hydroxyamino)-3-oxopropyl]-4-[(2-propan-2-yl-1-benzofuran-3-yl)methoxy]benzamide.
| Compound Name | N-[2-(4-benzylpiperazin-1-yl)-3-(hydroxyamino)-3-oxopropyl]-4-[(2-propan-2-yl-1-benzofuran-3-yl)methoxy]benzamide |
|---|---|
| PubChem CID | 75600398 |
| Molecular Formula | C33H38N4O5 |
| Molecular Weight | 570.69 g/mol |
| Exact Mass | 570.28 |
| IUPAC Name | N-[2-(4-benzylpiperazin-1-yl)-3-(hydroxyamino)-3-oxopropyl]-4-[(2-propan-2-yl-1-benzofuran-3-yl)methoxy]benzamide |
| SMILES | CC(C)c1oc2ccccc2c1COc1ccc(C(=O)NCC(C(=O)NO)N2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C33H38N4O5/c1-23(2)31-28(27-10-6-7-11-30(27)42-31)22-41-26-14-12-25(13-15-26)32(38)34-20-29(33(39)35-40)37-18-16-36(17-19-37)21-24-8-4-3-5-9-24/h3-15,23,29,40H,16-22H2,1-2H3,(H,34,38)(H,35,39) |
| InChIKey | ULAFIETVQGXWGL-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 107.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.69 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|