C30H31F3N6O4 — CID 75600335
N-[2-(4-benzylpiperazin-1-yl)-3-(hydroxyamino)-3-oxopropyl]-4-[[2-(trifluoromethyl)pyrazolo[1,5-a]pyridin-3-yl]methoxy]benzamide (PubChem CID 75600335) has the molecular formula C30H31F3N6O4 and a molecular weight of 596.61 g/mol. Its IUPAC name is N-[2-(4-benzylpiperazin-1-yl)-3-(hydroxyamino)-3-oxopropyl]-4-[[2-(trifluoromethyl)pyrazolo[1,5-a]pyridin-3-yl]methoxy]benzamide.
| Compound Name | N-[2-(4-benzylpiperazin-1-yl)-3-(hydroxyamino)-3-oxopropyl]-4-[[2-(trifluoromethyl)pyrazolo[1,5-a]pyridin-3-yl]methoxy]benzamide |
|---|---|
| PubChem CID | 75600335 |
| Molecular Formula | C30H31F3N6O4 |
| Molecular Weight | 596.61 g/mol |
| Exact Mass | 596.24 |
| IUPAC Name | N-[2-(4-benzylpiperazin-1-yl)-3-(hydroxyamino)-3-oxopropyl]-4-[[2-(trifluoromethyl)pyrazolo[1,5-a]pyridin-3-yl]methoxy]benzamide |
| SMILES | O=C(NCC(C(=O)NO)N1CCN(Cc2ccccc2)CC1)c1ccc(OCc2c(C(F)(F)F)nn3ccccc23)cc1 |
| InChI | InChI=1S/C30H31F3N6O4/c31-30(32,33)27-24(25-8-4-5-13-39(25)35-27)20-43-23-11-9-22(10-12-23)28(40)34-18-26(29(41)36-42)38-16-14-37(15-17-38)19-21-6-2-1-3-7-21/h1-13,26,42H,14-20H2,(H,34,40)(H,36,41) |
| InChIKey | PWHWIWBGOFSUOR-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 111.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.61 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|