C20H25F3N2O4 — CID 91487288
pentyl 3-amino-2-[(4-but-2-ynoxybenzoyl)amino]-4,4,4-trifluorobutanoate (PubChem CID 91487288) has the molecular formula C20H25F3N2O4 and a molecular weight of 414.42 g/mol. Its IUPAC name is pentyl 3-amino-2-[(4-but-2-ynoxybenzoyl)amino]-4,4,4-trifluorobutanoate.
| Compound Name | pentyl 3-amino-2-[(4-but-2-ynoxybenzoyl)amino]-4,4,4-trifluorobutanoate |
|---|---|
| PubChem CID | 91487288 |
| Molecular Formula | C20H25F3N2O4 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | pentyl 3-amino-2-[(4-but-2-ynoxybenzoyl)amino]-4,4,4-trifluorobutanoate |
| SMILES | CC#CCOc1ccc(C(=O)NC(C(=O)OCCCCC)C(N)C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H25F3N2O4/c1-3-5-7-13-29-19(27)16(17(24)20(21,22)23)25-18(26)14-8-10-15(11-9-14)28-12-6-4-2/h8-11,16-17H,3,5,7,12-13,24H2,1-2H3,(H,25,26) |
| InChIKey | CYSDDULHDLDXBC-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|