C15H19F3N2O4 — CID 70890771
ethyl (2S,3R)-3-amino-2-[(4-ethoxybenzoyl)amino]-4,4,4-trifluorobutanoate (PubChem CID 70890771) has the molecular formula C15H19F3N2O4 and a molecular weight of 348.32 g/mol. Its IUPAC name is ethyl (2S,3R)-3-amino-2-[(4-ethoxybenzoyl)amino]-4,4,4-trifluorobutanoate.
| Compound Name | ethyl (2S,3R)-3-amino-2-[(4-ethoxybenzoyl)amino]-4,4,4-trifluorobutanoate |
|---|---|
| PubChem CID | 70890771 |
| Molecular Formula | C15H19F3N2O4 |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | ethyl (2S,3R)-3-amino-2-[(4-ethoxybenzoyl)amino]-4,4,4-trifluorobutanoate |
| SMILES | CCOC(=O)[C@@H](NC(=O)c1ccc(OCC)cc1)[C@@H](N)C(F)(F)F |
| InChI | InChI=1S/C15H19F3N2O4/c1-3-23-10-7-5-9(6-8-10)13(21)20-11(14(22)24-4-2)12(19)15(16,17)18/h5-8,11-12H,3-4,19H2,1-2H3,(H,20,21)/t11-,12+/m0/s1 |
| InChIKey | QXHDLUHGZLTWLW-NWDGAFQWSA-N |
| XLogP | 1.64 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |