C21H23N5O4 — CID 58412875
(2S,3R)-3-hydroxy-2-[[4-[4-(2-pyrazin-2-ylethynyl)phenyl]piperazine-1-carbonyl]amino]butanoic acid (PubChem CID 58412875) has the molecular formula C21H23N5O4 and a molecular weight of 409.45 g/mol. Its IUPAC name is (2S,3R)-3-hydroxy-2-[[4-[4-(2-pyrazin-2-ylethynyl)phenyl]piperazine-1-carbonyl]amino]butanoic acid.
| Compound Name | (2S,3R)-3-hydroxy-2-[[4-[4-(2-pyrazin-2-ylethynyl)phenyl]piperazine-1-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 58412875 |
| Molecular Formula | C21H23N5O4 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | (2S,3R)-3-hydroxy-2-[[4-[4-(2-pyrazin-2-ylethynyl)phenyl]piperazine-1-carbonyl]amino]butanoic acid |
| SMILES | C[C@@H](O)[C@H](NC(=O)N1CCN(c2ccc(C#Cc3cnccn3)cc2)CC1)C(=O)O |
| InChI | InChI=1S/C21H23N5O4/c1-15(27)19(20(28)29)24-21(30)26-12-10-25(11-13-26)18-6-3-16(4-7-18)2-5-17-14-22-8-9-23-17/h3-4,6-9,14-15,19,27H,10-13H2,1H3,(H,24,30)(H,28,29)/t15-,19+/m1/s1 |
| InChIKey | BYCULWJQYQEPEA-BEFAXECRSA-N |
| XLogP | 0.54 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|