C11H12Cl2N2NaS2+ — CID 54608754
sodium 4-(3,4-dichlorophenyl)piperazine-1-carbodithioic acid (PubChem CID 54608754) has the molecular formula C11H12Cl2N2NaS2+ and a molecular weight of 330.26 g/mol. Its IUPAC name is sodium 4-(3,4-dichlorophenyl)piperazine-1-carbodithioic acid.
| Compound Name | sodium 4-(3,4-dichlorophenyl)piperazine-1-carbodithioic acid |
|---|---|
| PubChem CID | 54608754 |
| Molecular Formula | C11H12Cl2N2NaS2+ |
| Molecular Weight | 330.26 g/mol |
| Exact Mass | 328.97 |
| IUPAC Name | sodium 4-(3,4-dichlorophenyl)piperazine-1-carbodithioic acid |
| SMILES | S=C(S)N1CCN(c2ccc(Cl)c(Cl)c2)CC1.[Na+] |
| InChI | InChI=1S/C11H12Cl2N2S2.Na/c12-9-2-1-8(7-10(9)13)14-3-5-15(6-4-14)11(16)17;/h1-2,7H,3-6H2,(H,16,17);/q;+1 |
| InChIKey | OKSLPHJAMQPLLM-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 6.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.26 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|