C17H18Cl2N4S — CID 53257140
4-(3,4-dichlorophenyl)-N-(4-methyl-2-pyridinyl)piperazine-1-carbothioamide (PubChem CID 53257140) has the molecular formula C17H18Cl2N4S and a molecular weight of 381.33 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-N-(4-methyl-2-pyridinyl)piperazine-1-carbothioamide.
| Compound Name | 4-(3,4-dichlorophenyl)-N-(4-methyl-2-pyridinyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 53257140 |
| Molecular Formula | C17H18Cl2N4S |
| Molecular Weight | 381.33 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-N-(4-methyl-2-pyridinyl)piperazine-1-carbothioamide |
| SMILES | Cc1ccnc(NC(=S)N2CCN(c3ccc(Cl)c(Cl)c3)CC2)c1 |
| InChI | InChI=1S/C17H18Cl2N4S/c1-12-4-5-20-16(10-12)21-17(24)23-8-6-22(7-9-23)13-2-3-14(18)15(19)11-13/h2-5,10-11H,6-9H2,1H3,(H,20,21,24) |
| InChIKey | BRHDZARXWTXWMR-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.33 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|