C18H18F3N5O2S — CID 53257196
N-(4-methyl-2-pyridinyl)-4-[2-nitro-4-(trifluoromethyl)phenyl]piperazine-1-carbothioamide (PubChem CID 53257196) has the molecular formula C18H18F3N5O2S and a molecular weight of 425.44 g/mol. Its IUPAC name is N-(4-methyl-2-pyridinyl)-4-[2-nitro-4-(trifluoromethyl)phenyl]piperazine-1-carbothioamide.
| Compound Name | N-(4-methyl-2-pyridinyl)-4-[2-nitro-4-(trifluoromethyl)phenyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 53257196 |
| Molecular Formula | C18H18F3N5O2S |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | N-(4-methyl-2-pyridinyl)-4-[2-nitro-4-(trifluoromethyl)phenyl]piperazine-1-carbothioamide |
| SMILES | Cc1ccnc(NC(=S)N2CCN(c3ccc(C(F)(F)F)cc3[N+](=O)[O-])CC2)c1 |
| InChI | InChI=1S/C18H18F3N5O2S/c1-12-4-5-22-16(10-12)23-17(29)25-8-6-24(7-9-25)14-3-2-13(18(19,20)21)11-15(14)26(27)28/h2-5,10-11H,6-9H2,1H3,(H,22,23,29) |
| InChIKey | AGWAEWJPKFNDHK-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 74.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|