C12H13FN4S — CID 114080613
4-(5-fluoro-3-pyridinyl)-2-piperazin-1-yl-1,3-thiazole (PubChem CID 114080613) has the molecular formula C12H13FN4S and a molecular weight of 264.33 g/mol. Its IUPAC name is 4-(5-fluoro-3-pyridinyl)-2-piperazin-1-yl-1,3-thiazole.
| Compound Name | 4-(5-fluoro-3-pyridinyl)-2-piperazin-1-yl-1,3-thiazole |
|---|---|
| PubChem CID | 114080613 |
| Molecular Formula | C12H13FN4S |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 4-(5-fluoro-3-pyridinyl)-2-piperazin-1-yl-1,3-thiazole |
| SMILES | Fc1cncc(-c2csc(N3CCNCC3)n2)c1 |
| InChI | InChI=1S/C12H13FN4S/c13-10-5-9(6-15-7-10)11-8-18-12(16-11)17-3-1-14-2-4-17/h5-8,14H,1-4H2 |
| InChIKey | VKKPZMKJRMZOCB-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |