C16H17ClN4S — CID 173041144
2-piperazin-1-yl-4-quinolin-2-yl-1,3-thiazole;hydrochloride (PubChem CID 173041144) has the molecular formula C16H17ClN4S and a molecular weight of 332.86 g/mol. Its IUPAC name is 2-piperazin-1-yl-4-quinolin-2-yl-1,3-thiazole;hydrochloride.
| Compound Name | 2-piperazin-1-yl-4-quinolin-2-yl-1,3-thiazole;hydrochloride |
|---|---|
| PubChem CID | 173041144 |
| Molecular Formula | C16H17ClN4S |
| Molecular Weight | 332.86 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 2-piperazin-1-yl-4-quinolin-2-yl-1,3-thiazole;hydrochloride |
| SMILES | Cl.c1ccc2nc(-c3csc(N4CCNCC4)n3)ccc2c1 |
| InChI | InChI=1S/C16H16N4S.ClH/c1-2-4-13-12(3-1)5-6-14(18-13)15-11-21-16(19-15)20-9-7-17-8-10-20;/h1-6,11,17H,7-10H2;1H |
| InChIKey | PZTJBDLFWXFIHS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.86 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |