C19H13ClN2O3S — CID 1128729
3-[2-(4-chloroanilino)-1,3-thiazol-4-yl]-8-methoxychromen-2-one (PubChem CID 1128729) has the molecular formula C19H13ClN2O3S and a molecular weight of 384.84 g/mol. Its IUPAC name is 3-[2-(4-chloroanilino)-1,3-thiazol-4-yl]-8-methoxychromen-2-one.
| Compound Name | 3-[2-(4-chloroanilino)-1,3-thiazol-4-yl]-8-methoxychromen-2-one |
|---|---|
| PubChem CID | 1128729 |
| Molecular Formula | C19H13ClN2O3S |
| Molecular Weight | 384.84 g/mol |
| Exact Mass | 384.03 |
| IUPAC Name | 3-[2-(4-chloroanilino)-1,3-thiazol-4-yl]-8-methoxychromen-2-one |
| SMILES | COc1cccc2cc(-c3csc(Nc4ccc(Cl)cc4)n3)c(=O)oc12 |
| InChI | InChI=1S/C19H13ClN2O3S/c1-24-16-4-2-3-11-9-14(18(23)25-17(11)16)15-10-26-19(22-15)21-13-7-5-12(20)6-8-13/h2-10H,1H3,(H,21,22) |
| InChIKey | HPMWIZVCBNRDAR-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.84 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|