C17H11NO3S2 — CID 3239008
8-methoxy-3-(4-thiophen-2-yl-1,3-thiazol-2-yl)chromen-2-one (PubChem CID 3239008) has the molecular formula C17H11NO3S2 and a molecular weight of 341.41 g/mol. Its IUPAC name is 8-methoxy-3-(4-thiophen-2-yl-1,3-thiazol-2-yl)chromen-2-one.
| Compound Name | 8-methoxy-3-(4-thiophen-2-yl-1,3-thiazol-2-yl)chromen-2-one |
|---|---|
| PubChem CID | 3239008 |
| Molecular Formula | C17H11NO3S2 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | 8-methoxy-3-(4-thiophen-2-yl-1,3-thiazol-2-yl)chromen-2-one |
| SMILES | COc1cccc2cc(-c3nc(-c4cccs4)cs3)c(=O)oc12 |
| InChI | InChI=1S/C17H11NO3S2/c1-20-13-5-2-4-10-8-11(17(19)21-15(10)13)16-18-12(9-23-16)14-6-3-7-22-14/h2-9H,1H3 |
| InChIKey | KBDDDYILGDJCJK-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|