C19H14N2O4S — CID 1159991
3-[2-(4-hydroxyanilino)-1,3-thiazol-4-yl]-8-methoxychromen-2-one (PubChem CID 1159991) has the molecular formula C19H14N2O4S and a molecular weight of 366.40 g/mol. Its IUPAC name is 3-[2-(4-hydroxyanilino)-1,3-thiazol-4-yl]-8-methoxychromen-2-one.
| Compound Name | 3-[2-(4-hydroxyanilino)-1,3-thiazol-4-yl]-8-methoxychromen-2-one |
|---|---|
| PubChem CID | 1159991 |
| Molecular Formula | C19H14N2O4S |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | 3-[2-(4-hydroxyanilino)-1,3-thiazol-4-yl]-8-methoxychromen-2-one |
| SMILES | COc1cccc2cc(-c3csc(Nc4ccc(O)cc4)n3)c(=O)oc12 |
| InChI | InChI=1S/C19H14N2O4S/c1-24-16-4-2-3-11-9-14(18(23)25-17(11)16)15-10-26-19(21-15)20-12-5-7-13(22)8-6-12/h2-10,22H,1H3,(H,20,21) |
| InChIKey | NMKXQKDVWHPZCO-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 84.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|