C21H17ClN2O3S — CID 4523553
3-[2-(3-chloroanilino)-5-ethyl-1,3-thiazol-4-yl]-8-methoxychromen-2-one (PubChem CID 4523553) has the molecular formula C21H17ClN2O3S and a molecular weight of 412.90 g/mol. Its IUPAC name is 3-[2-(3-chloroanilino)-5-ethyl-1,3-thiazol-4-yl]-8-methoxychromen-2-one.
| Compound Name | 3-[2-(3-chloroanilino)-5-ethyl-1,3-thiazol-4-yl]-8-methoxychromen-2-one |
|---|---|
| PubChem CID | 4523553 |
| Molecular Formula | C21H17ClN2O3S |
| Molecular Weight | 412.90 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | 3-[2-(3-chloroanilino)-5-ethyl-1,3-thiazol-4-yl]-8-methoxychromen-2-one |
| SMILES | CCc1sc(Nc2cccc(Cl)c2)nc1-c1cc2cccc(OC)c2oc1=O |
| InChI | InChI=1S/C21H17ClN2O3S/c1-3-17-18(24-21(28-17)23-14-8-5-7-13(22)11-14)15-10-12-6-4-9-16(26-2)19(12)27-20(15)25/h4-11H,3H2,1-2H3,(H,23,24) |
| InChIKey | XXZSWDKXNMTBJE-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.90 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|