C22H20ClN3O3S — CID 118688966
8-chloro-3-[2-[2-[3-(methylamino)propoxy]anilino]-1,3-thiazol-4-yl]chromen-2-one (PubChem CID 118688966) has the molecular formula C22H20ClN3O3S and a molecular weight of 441.94 g/mol. Its IUPAC name is 8-chloro-3-[2-[2-[3-(methylamino)propoxy]anilino]-1,3-thiazol-4-yl]chromen-2-one.
| Compound Name | 8-chloro-3-[2-[2-[3-(methylamino)propoxy]anilino]-1,3-thiazol-4-yl]chromen-2-one |
|---|---|
| PubChem CID | 118688966 |
| Molecular Formula | C22H20ClN3O3S |
| Molecular Weight | 441.94 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | 8-chloro-3-[2-[2-[3-(methylamino)propoxy]anilino]-1,3-thiazol-4-yl]chromen-2-one |
| SMILES | CNCCCOc1ccccc1Nc1nc(-c2cc3cccc(Cl)c3oc2=O)cs1 |
| InChI | InChI=1S/C22H20ClN3O3S/c1-24-10-5-11-28-19-9-3-2-8-17(19)25-22-26-18(13-30-22)15-12-14-6-4-7-16(23)20(14)29-21(15)27/h2-4,6-9,12-13,24H,5,10-11H2,1H3,(H,25,26) |
| InChIKey | LOKZKQDRKKAVMK-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.94 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|