C26H26N4O6 — CID 135891416
7-hydroxy-N-[6-[(7-hydroxy-2-iminochromene-3-carbonyl)amino]hexyl]-2-iminochromene-3-carboxamide (PubChem CID 135891416) has the molecular formula C26H26N4O6 and a molecular weight of 490.52 g/mol. Its IUPAC name is 7-hydroxy-N-[6-[(7-hydroxy-2-iminochromene-3-carbonyl)amino]hexyl]-2-iminochromene-3-carboxamide.
| Compound Name | 7-hydroxy-N-[6-[(7-hydroxy-2-iminochromene-3-carbonyl)amino]hexyl]-2-iminochromene-3-carboxamide |
|---|---|
| PubChem CID | 135891416 |
| Molecular Formula | C26H26N4O6 |
| Molecular Weight | 490.52 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | 7-hydroxy-N-[6-[(7-hydroxy-2-iminochromene-3-carbonyl)amino]hexyl]-2-iminochromene-3-carboxamide |
| SMILES | [H]/N=c1\oc2cc(O)ccc2cc1C(=O)NCCCCCCNC(=O)c1cc2ccc(O)cc2o/c1=N\[H] |
| InChI | InChI=1S/C26H26N4O6/c27-23-19(11-15-5-7-17(31)13-21(15)35-23)25(33)29-9-3-1-2-4-10-30-26(34)20-12-16-6-8-18(32)14-22(16)36-24(20)28/h5-8,11-14,27-28,31-32H,1-4,9-10H2,(H,29,33)(H,30,34)/b27-23-,28-24- |
| InChIKey | WGQLRTMCIVQULX-JTFGNLGHSA-N |
| XLogP | 3.27 |
| TPSA | 172.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.52 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|