C16H18N2O5 — CID 146244908
7-hydroxy-N-[(3S)-3-(methylamino)-4-oxopentyl]-2-oxochromene-3-carboxamide (PubChem CID 146244908) has the molecular formula C16H18N2O5 and a molecular weight of 318.33 g/mol. Its IUPAC name is 7-hydroxy-N-[(3S)-3-(methylamino)-4-oxopentyl]-2-oxochromene-3-carboxamide.
| Compound Name | 7-hydroxy-N-[(3S)-3-(methylamino)-4-oxopentyl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 146244908 |
| Molecular Formula | C16H18N2O5 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 7-hydroxy-N-[(3S)-3-(methylamino)-4-oxopentyl]-2-oxochromene-3-carboxamide |
| SMILES | CN[C@@H](CCNC(=O)c1cc2ccc(O)cc2oc1=O)C(C)=O |
| InChI | InChI=1S/C16H18N2O5/c1-9(19)13(17-2)5-6-18-15(21)12-7-10-3-4-11(20)8-14(10)23-16(12)22/h3-4,7-8,13,17,20H,5-6H2,1-2H3,(H,18,21)/t13-/m0/s1 |
| InChIKey | VABPNHYSZMDBBP-ZDUSSCGKSA-N |
| XLogP | 0.80 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|