C26H24N2O9 — CID 161031650
3-acetyl-7-hydroxychromen-2-one;7-hydroxy-N-[(2S)-2-(methylamino)-3-oxobutyl]-2-oxochromene-3-carboxamide (PubChem CID 161031650) has the molecular formula C26H24N2O9 and a molecular weight of 508.48 g/mol. Its IUPAC name is 3-acetyl-7-hydroxychromen-2-one;7-hydroxy-N-[(2S)-2-(methylamino)-3-oxobutyl]-2-oxochromene-3-carboxamide.
| Compound Name | 3-acetyl-7-hydroxychromen-2-one;7-hydroxy-N-[(2S)-2-(methylamino)-3-oxobutyl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 161031650 |
| Molecular Formula | C26H24N2O9 |
| Molecular Weight | 508.48 g/mol |
| Exact Mass | 508.15 |
| IUPAC Name | 3-acetyl-7-hydroxychromen-2-one;7-hydroxy-N-[(2S)-2-(methylamino)-3-oxobutyl]-2-oxochromene-3-carboxamide |
| SMILES | CC(=O)c1cc2ccc(O)cc2oc1=O.CN[C@@H](CNC(=O)c1cc2ccc(O)cc2oc1=O)C(C)=O |
| InChI | InChI=1S/C15H16N2O5.C11H8O4/c1-8(18)12(16-2)7-17-14(20)11-5-9-3-4-10(19)6-13(9)22-15(11)21;1-6(12)9-4-7-2-3-8(13)5-10(7)15-11(9)14/h3-6,12,16,19H,7H2,1-2H3,(H,17,20);2-5,13H,1H3/t12-;/m0./s1 |
| InChIKey | TZRVISYLQYUVSL-YDALLXLXSA-N |
| XLogP | 2.11 |
| TPSA | 176.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.48 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|