C19H11F5N2O5 — CID 19074029
7-hydroxy-2-oxo-N-[1-[(2,3,4,5,6-pentafluorobenzoyl)amino]ethyl]chromene-3-carboxamide (PubChem CID 19074029) has the molecular formula C19H11F5N2O5 and a molecular weight of 442.30 g/mol. Its IUPAC name is 7-hydroxy-2-oxo-N-[1-[(2,3,4,5,6-pentafluorobenzoyl)amino]ethyl]chromene-3-carboxamide.
| Compound Name | 7-hydroxy-2-oxo-N-[1-[(2,3,4,5,6-pentafluorobenzoyl)amino]ethyl]chromene-3-carboxamide |
|---|---|
| PubChem CID | 19074029 |
| Molecular Formula | C19H11F5N2O5 |
| Molecular Weight | 442.30 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | 7-hydroxy-2-oxo-N-[1-[(2,3,4,5,6-pentafluorobenzoyl)amino]ethyl]chromene-3-carboxamide |
| SMILES | CC(NC(=O)c1c(F)c(F)c(F)c(F)c1F)NC(=O)c1cc2ccc(O)cc2oc1=O |
| InChI | InChI=1S/C19H11F5N2O5/c1-6(26-18(29)11-12(20)14(22)16(24)15(23)13(11)21)25-17(28)9-4-7-2-3-8(27)5-10(7)31-19(9)30/h2-6,27H,1H3,(H,25,28)(H,26,29) |
| InChIKey | SZXMVFLGCLRQTC-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.30 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|