C16H5F5O4 — CID 19074026
7-hydroxy-3-(2,3,4,5,6-pentafluorobenzoyl)chromen-2-one (PubChem CID 19074026) has the molecular formula C16H5F5O4 and a molecular weight of 356.20 g/mol. Its IUPAC name is 7-hydroxy-3-(2,3,4,5,6-pentafluorobenzoyl)chromen-2-one.
| Compound Name | 7-hydroxy-3-(2,3,4,5,6-pentafluorobenzoyl)chromen-2-one |
|---|---|
| PubChem CID | 19074026 |
| Molecular Formula | C16H5F5O4 |
| Molecular Weight | 356.20 g/mol |
| Exact Mass | 356.01 |
| IUPAC Name | 7-hydroxy-3-(2,3,4,5,6-pentafluorobenzoyl)chromen-2-one |
| SMILES | O=C(c1c(F)c(F)c(F)c(F)c1F)c1cc2ccc(O)cc2oc1=O |
| InChI | InChI=1S/C16H5F5O4/c17-10-9(11(18)13(20)14(21)12(10)19)15(23)7-3-5-1-2-6(22)4-8(5)25-16(7)24/h1-4,22H |
| InChIKey | GYNXMQDBQNHMLX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.20 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|