C14H14N2O4 — CID 145271180
N-(2-aminobut-3-enyl)-7-hydroxy-2-oxochromene-3-carboxamide (PubChem CID 145271180) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is N-(2-aminobut-3-enyl)-7-hydroxy-2-oxochromene-3-carboxamide.
| Compound Name | N-(2-aminobut-3-enyl)-7-hydroxy-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 145271180 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | N-(2-aminobut-3-enyl)-7-hydroxy-2-oxochromene-3-carboxamide |
| SMILES | C=CC(N)CNC(=O)c1cc2ccc(O)cc2oc1=O |
| InChI | InChI=1S/C14H14N2O4/c1-2-9(15)7-16-13(18)11-5-8-3-4-10(17)6-12(8)20-14(11)19/h2-6,9,17H,1,7,15H2,(H,16,18) |
| InChIKey | FJYASVHWSMRSIH-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|