C15H17NO4 — CID 167772657
1,7-dihydroxy-N-(4-hydroxybutyl)naphthalene-2-carboxamide (PubChem CID 167772657) has the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. Its IUPAC name is 1,7-dihydroxy-N-(4-hydroxybutyl)naphthalene-2-carboxamide.
| Compound Name | 1,7-dihydroxy-N-(4-hydroxybutyl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 167772657 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 1,7-dihydroxy-N-(4-hydroxybutyl)naphthalene-2-carboxamide |
| SMILES | O=C(NCCCCO)c1ccc2ccc(O)cc2c1O |
| InChI | InChI=1S/C15H17NO4/c17-8-2-1-7-16-15(20)12-6-4-10-3-5-11(18)9-13(10)14(12)19/h3-6,9,17-19H,1-2,7-8H2,(H,16,20) |
| InChIKey | ZDDBSNAHTGBLBP-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|