C16H12N2O5 — CID 135409466
5,7-dihydroxy-N-(4-hydroxyphenyl)-2-iminochromene-3-carboxamide (PubChem CID 135409466) has the molecular formula C16H12N2O5 and a molecular weight of 312.28 g/mol. Its IUPAC name is 5,7-dihydroxy-N-(4-hydroxyphenyl)-2-iminochromene-3-carboxamide.
| Compound Name | 5,7-dihydroxy-N-(4-hydroxyphenyl)-2-iminochromene-3-carboxamide |
|---|---|
| PubChem CID | 135409466 |
| Molecular Formula | C16H12N2O5 |
| Molecular Weight | 312.28 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 5,7-dihydroxy-N-(4-hydroxyphenyl)-2-iminochromene-3-carboxamide |
| SMILES | [H]/N=c1\oc2cc(O)cc(O)c2cc1C(=O)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C16H12N2O5/c17-15-12(16(22)18-8-1-3-9(19)4-2-8)7-11-13(21)5-10(20)6-14(11)23-15/h1-7,17,19-21H,(H,18,22)/b17-15- |
| InChIKey | GCHFSPLKZAPCEO-ICFOKQHNSA-N |
| XLogP | 2.28 |
| TPSA | 126.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.28 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|