C16H12N2O4 — CID 10402283
8-hydroxy-N-(3-hydroxyphenyl)-2-iminochromene-3-carboxamide (PubChem CID 10402283) has the molecular formula C16H12N2O4 and a molecular weight of 296.28 g/mol. Its IUPAC name is 8-hydroxy-N-(3-hydroxyphenyl)-2-iminochromene-3-carboxamide.
| Compound Name | 8-hydroxy-N-(3-hydroxyphenyl)-2-iminochromene-3-carboxamide |
|---|---|
| PubChem CID | 10402283 |
| Molecular Formula | C16H12N2O4 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 8-hydroxy-N-(3-hydroxyphenyl)-2-iminochromene-3-carboxamide |
| SMILES | [H]/N=c1\oc2c(O)cccc2cc1C(=O)Nc1cccc(O)c1 |
| InChI | InChI=1S/C16H12N2O4/c17-15-12(7-9-3-1-6-13(20)14(9)22-15)16(21)18-10-4-2-5-11(19)8-10/h1-8,17,19-20H,(H,18,21)/b17-15- |
| InChIKey | ZWHZPZUQLRMMME-ICFOKQHNSA-N |
| XLogP | 2.58 |
| TPSA | 106.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |