C20H20N2O5S — CID 19289071
propan-2-yl 2-[(8-ethoxy-2-iminochromene-3-carbonyl)amino]thiophene-3-carboxylate (PubChem CID 19289071) has the molecular formula C20H20N2O5S and a molecular weight of 400.46 g/mol. Its IUPAC name is propan-2-yl 2-[(8-ethoxy-2-iminochromene-3-carbonyl)amino]thiophene-3-carboxylate.
| Compound Name | propan-2-yl 2-[(8-ethoxy-2-iminochromene-3-carbonyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19289071 |
| Molecular Formula | C20H20N2O5S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | propan-2-yl 2-[(8-ethoxy-2-iminochromene-3-carbonyl)amino]thiophene-3-carboxylate |
| SMILES | [H]/N=c1\oc2c(OCC)cccc2cc1C(=O)Nc1sccc1C(=O)OC(C)C |
| InChI | InChI=1S/C20H20N2O5S/c1-4-25-15-7-5-6-12-10-14(17(21)27-16(12)15)18(23)22-19-13(8-9-28-19)20(24)26-11(2)3/h5-11,21H,4H2,1-3H3,(H,22,23)/b21-17- |
| InChIKey | JFXQWMFCXVQZNS-FXBPSFAMSA-N |
| XLogP | 4.19 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |