C23H17BrN2O4S — CID 15988898
ethyl 2-[[5-(4-bromophenyl)-1,2-oxazole-3-carbonyl]amino]-4-phenylthiophene-3-carboxylate (PubChem CID 15988898) has the molecular formula C23H17BrN2O4S and a molecular weight of 497.37 g/mol. Its IUPAC name is ethyl 2-[[5-(4-bromophenyl)-1,2-oxazole-3-carbonyl]amino]-4-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[5-(4-bromophenyl)-1,2-oxazole-3-carbonyl]amino]-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 15988898 |
| Molecular Formula | C23H17BrN2O4S |
| Molecular Weight | 497.37 g/mol |
| Exact Mass | 496.01 |
| IUPAC Name | ethyl 2-[[5-(4-bromophenyl)-1,2-oxazole-3-carbonyl]amino]-4-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)csc1NC(=O)c1cc(-c2ccc(Br)cc2)on1 |
| InChI | InChI=1S/C23H17BrN2O4S/c1-2-29-23(28)20-17(14-6-4-3-5-7-14)13-31-22(20)25-21(27)18-12-19(30-26-18)15-8-10-16(24)11-9-15/h3-13H,2H2,1H3,(H,25,27) |
| InChIKey | JSCQDZBVBRTVNL-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.37 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|