C17H11F13N2O3S — CID 3624123
propan-2-yl 4-cyano-3-methyl-5-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoylamino)thiophene-2-carboxylate (PubChem CID 3624123) has the molecular formula C17H11F13N2O3S and a molecular weight of 570.33 g/mol. Its IUPAC name is propan-2-yl 4-cyano-3-methyl-5-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoylamino)thiophene-2-carboxylate.
| Compound Name | propan-2-yl 4-cyano-3-methyl-5-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoylamino)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 3624123 |
| Molecular Formula | C17H11F13N2O3S |
| Molecular Weight | 570.33 g/mol |
| Exact Mass | 570.03 |
| IUPAC Name | propan-2-yl 4-cyano-3-methyl-5-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoylamino)thiophene-2-carboxylate |
| SMILES | Cc1c(C(=O)OC(C)C)sc(NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1C#N |
| InChI | InChI=1S/C17H11F13N2O3S/c1-5(2)35-10(33)8-6(3)7(4-31)9(36-8)32-11(34)12(18,19)13(20,21)14(22,23)15(24,25)16(26,27)17(28,29)30/h5H,1-3H3,(H,32,34) |
| InChIKey | PDRPWXRQQCLWDI-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.33 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|