C22H18ClF16NO5S — CID 3502875
dipropan-2-yl 5-[(9-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanoyl)amino]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 3502875) has the molecular formula C22H18ClF16NO5S and a molecular weight of 747.88 g/mol. Its IUPAC name is dipropan-2-yl 5-[(9-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanoyl)amino]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | dipropan-2-yl 5-[(9-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanoyl)amino]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 3502875 |
| Molecular Formula | C22H18ClF16NO5S |
| Molecular Weight | 747.88 g/mol |
| Exact Mass | 747.03 |
| IUPAC Name | dipropan-2-yl 5-[(9-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanoyl)amino]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | Cc1c(C(=O)OC(C)C)sc(NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl)c1C(=O)OC(C)C |
| InChI | InChI=1S/C22H18ClF16NO5S/c1-6(2)44-12(41)9-8(5)10(13(42)45-7(3)4)46-11(9)40-14(43)15(24,25)16(26,27)17(28,29)18(30,31)19(32,33)20(34,35)21(36,37)22(23,38)39/h6-7H,1-5H3,(H,40,43) |
| InChIKey | ZYOUPYZWOZRRAQ-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.88 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|