C18H9ClF16N2O3S — CID 4283202
ethyl 5-[(9-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanoyl)amino]-4-cyano-3-methylthiophene-2-carboxylate (PubChem CID 4283202) has the molecular formula C18H9ClF16N2O3S and a molecular weight of 672.77 g/mol. Its IUPAC name is ethyl 5-[(9-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanoyl)amino]-4-cyano-3-methylthiophene-2-carboxylate.
| Compound Name | ethyl 5-[(9-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanoyl)amino]-4-cyano-3-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 4283202 |
| Molecular Formula | C18H9ClF16N2O3S |
| Molecular Weight | 672.77 g/mol |
| Exact Mass | 671.98 |
| IUPAC Name | ethyl 5-[(9-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanoyl)amino]-4-cyano-3-methylthiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl)c(C#N)c1C |
| InChI | InChI=1S/C18H9ClF16N2O3S/c1-3-40-9(38)7-5(2)6(4-36)8(41-7)37-10(39)11(20,21)12(22,23)13(24,25)14(26,27)15(28,29)16(30,31)17(32,33)18(19,34)35/h3H2,1-2H3,(H,37,39) |
| InChIKey | UPYKFORQUOJGKH-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.77 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|