C24H15F7N6O2S2 — CID 19456013
6-(difluoromethyl)-3-[[5-methyl-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidine-2-carbonyl]amino]-4-(5-methylthiophen-2-yl)thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 19456013) has the molecular formula C24H15F7N6O2S2 and a molecular weight of 616.54 g/mol. Its IUPAC name is 6-(difluoromethyl)-3-[[5-methyl-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidine-2-carbonyl]amino]-4-(5-methylthiophen-2-yl)thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 6-(difluoromethyl)-3-[[5-methyl-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidine-2-carbonyl]amino]-4-(5-methylthiophen-2-yl)thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 19456013 |
| Molecular Formula | C24H15F7N6O2S2 |
| Molecular Weight | 616.54 g/mol |
| Exact Mass | 616.06 |
| IUPAC Name | 6-(difluoromethyl)-3-[[5-methyl-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidine-2-carbonyl]amino]-4-(5-methylthiophen-2-yl)thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | Cc1cc(C(F)(F)C(F)(F)F)n2nc(C(=O)Nc3c(C(N)=O)sc4nc(C(F)F)cc(-c5ccc(C)s5)c34)cc2n1 |
| InChI | InChI=1S/C24H15F7N6O2S2/c1-8-5-14(23(27,28)24(29,30)31)37-15(33-8)7-12(36-37)21(39)35-17-16-10(13-4-3-9(2)40-13)6-11(19(25)26)34-22(16)41-18(17)20(32)38/h3-7,19H,1-2H3,(H2,32,38)(H,35,39) |
| InChIKey | RDQLMCIHWKMZFR-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 115.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.54 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|