C24H17F7N8O2S — CID 19455967
6-(difluoromethyl)-4-(1,3-dimethylpyrazol-4-yl)-3-[[5-methyl-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidine-2-carbonyl]amino]thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 19455967) has the molecular formula C24H17F7N8O2S and a molecular weight of 614.51 g/mol. Its IUPAC name is 6-(difluoromethyl)-4-(1,3-dimethylpyrazol-4-yl)-3-[[5-methyl-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidine-2-carbonyl]amino]thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 6-(difluoromethyl)-4-(1,3-dimethylpyrazol-4-yl)-3-[[5-methyl-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidine-2-carbonyl]amino]thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 19455967 |
| Molecular Formula | C24H17F7N8O2S |
| Molecular Weight | 614.51 g/mol |
| Exact Mass | 614.11 |
| IUPAC Name | 6-(difluoromethyl)-4-(1,3-dimethylpyrazol-4-yl)-3-[[5-methyl-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidine-2-carbonyl]amino]thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | Cc1cc(C(F)(F)C(F)(F)F)n2nc(C(=O)Nc3c(C(N)=O)sc4nc(C(F)F)cc(-c5cn(C)nc5C)c34)cc2n1 |
| InChI | InChI=1S/C24H17F7N8O2S/c1-8-4-14(23(27,28)24(29,30)31)39-15(33-8)6-13(37-39)21(41)35-17-16-10(11-7-38(3)36-9(11)2)5-12(19(25)26)34-22(16)42-18(17)20(32)40/h4-7,19H,1-3H3,(H2,32,40)(H,35,41) |
| InChIKey | YXURQRDHRPVUDG-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 133.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.51 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|