C15H16N4O8S — CID 19510937
2-O-ethyl 4-O-methyl 5-[(3-methoxy-4-nitro-1H-pyrazole-5-carbonyl)amino]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 19510937) has the molecular formula C15H16N4O8S and a molecular weight of 412.38 g/mol. Its IUPAC name is 2-O-ethyl 4-O-methyl 5-[(3-methoxy-4-nitro-1H-pyrazole-5-carbonyl)amino]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | 2-O-ethyl 4-O-methyl 5-[(3-methoxy-4-nitro-1H-pyrazole-5-carbonyl)amino]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 19510937 |
| Molecular Formula | C15H16N4O8S |
| Molecular Weight | 412.38 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | 2-O-ethyl 4-O-methyl 5-[(3-methoxy-4-nitro-1H-pyrazole-5-carbonyl)amino]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)c2[nH]nc(OC)c2[N+](=O)[O-])c(C(=O)OC)c1C |
| InChI | InChI=1S/C15H16N4O8S/c1-5-27-15(22)10-6(2)7(14(21)26-4)13(28-10)16-11(20)8-9(19(23)24)12(25-3)18-17-8/h5H2,1-4H3,(H,16,20)(H,17,18) |
| InChIKey | QEHCTXMXMMFULA-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 162.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.38 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|